C25H26ClN3O4 — CID 55906524
2-chloro-N-cyclohexyl-5-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide (PubChem CID 55906524) has the molecular formula C25H26ClN3O4 and a molecular weight of 467.95 g/mol. Its IUPAC name is 2-chloro-N-cyclohexyl-5-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide.
| Compound Name | 2-chloro-N-cyclohexyl-5-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
|---|---|
| PubChem CID | 55906524 |
| Molecular Formula | C25H26ClN3O4 |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | 2-chloro-N-cyclohexyl-5-[3-(5-methyl-1,3-dioxoisoindol-2-yl)propanoylamino]benzamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCC(=O)Nc1ccc(Cl)c(C(=O)NC3CCCCC3)c1)C2=O |
| InChI | InChI=1S/C25H26ClN3O4/c1-15-7-9-18-19(13-15)25(33)29(24(18)32)12-11-22(30)27-17-8-10-21(26)20(14-17)23(31)28-16-5-3-2-4-6-16/h7-10,13-14,16H,2-6,11-12H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | PTMBYOYTKCBHLR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|