C23H23F2N3O2S — CID 55907645
5-[(3-fluorobenzoyl)amino]-N-[3-(2-fluoro-N-methylanilino)propyl]-3-methylthiophene-2-carboxamide (PubChem CID 55907645) has the molecular formula C23H23F2N3O2S and a molecular weight of 443.52 g/mol. Its IUPAC name is 5-[(3-fluorobenzoyl)amino]-N-[3-(2-fluoro-N-methylanilino)propyl]-3-methylthiophene-2-carboxamide.
| Compound Name | 5-[(3-fluorobenzoyl)amino]-N-[3-(2-fluoro-N-methylanilino)propyl]-3-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55907645 |
| Molecular Formula | C23H23F2N3O2S |
| Molecular Weight | 443.52 g/mol |
| Exact Mass | 443.15 |
| IUPAC Name | 5-[(3-fluorobenzoyl)amino]-N-[3-(2-fluoro-N-methylanilino)propyl]-3-methylthiophene-2-carboxamide |
| SMILES | Cc1cc(NC(=O)c2cccc(F)c2)sc1C(=O)NCCCN(C)c1ccccc1F |
| InChI | InChI=1S/C23H23F2N3O2S/c1-15-13-20(27-22(29)16-7-5-8-17(24)14-16)31-21(15)23(30)26-11-6-12-28(2)19-10-4-3-9-18(19)25/h3-5,7-10,13-14H,6,11-12H2,1-2H3,(H,26,30)(H,27,29) |
| InChIKey | HMQNHOMIPKCRGF-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.52 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|