C17H15IN4O2 — CID 55908267
2-(4-iodophenoxy)-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide (PubChem CID 55908267) has the molecular formula C17H15IN4O2 and a molecular weight of 434.24 g/mol. Its IUPAC name is 2-(4-iodophenoxy)-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-(4-iodophenoxy)-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55908267 |
| Molecular Formula | C17H15IN4O2 |
| Molecular Weight | 434.24 g/mol |
| Exact Mass | 434.02 |
| IUPAC Name | 2-(4-iodophenoxy)-N-[2-(1,2,4-triazol-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(COc1ccc(I)cc1)Nc1ccccc1Cn1cncn1 |
| InChI | InChI=1S/C17H15IN4O2/c18-14-5-7-15(8-6-14)24-10-17(23)21-16-4-2-1-3-13(16)9-22-12-19-11-20-22/h1-8,11-12H,9-10H2,(H,21,23) |
| InChIKey | TZYOFFVGJFQIPP-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.24 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|