C18H17F2N3OS — CID 55908733
2-[(4-cyanophenyl)methylsulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide (PubChem CID 55908733) has the molecular formula C18H17F2N3OS and a molecular weight of 361.42 g/mol. Its IUPAC name is 2-[(4-cyanophenyl)methylsulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide.
| Compound Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide |
|---|---|
| PubChem CID | 55908733 |
| Molecular Formula | C18H17F2N3OS |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.11 |
| IUPAC Name | 2-[(4-cyanophenyl)methylsulfanyl]-N-[4-(dimethylamino)-3,5-difluorophenyl]acetamide |
| SMILES | CN(C)c1c(F)cc(NC(=O)CSCc2ccc(C#N)cc2)cc1F |
| InChI | InChI=1S/C18H17F2N3OS/c1-23(2)18-15(19)7-14(8-16(18)20)22-17(24)11-25-10-13-5-3-12(9-21)4-6-13/h3-8H,10-11H2,1-2H3,(H,22,24) |
| InChIKey | PQSIMINYUQKTAV-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|