C25H26N4O — CID 55909303
1-(3,3-diphenylpropyl)-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea (PubChem CID 55909303) has the molecular formula C25H26N4O and a molecular weight of 398.51 g/mol. Its IUPAC name is 1-(3,3-diphenylpropyl)-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea.
| Compound Name | 1-(3,3-diphenylpropyl)-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
|---|---|
| PubChem CID | 55909303 |
| Molecular Formula | C25H26N4O |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(3,3-diphenylpropyl)-3-[(7-methylimidazo[1,2-a]pyridin-2-yl)methyl]urea |
| SMILES | Cc1ccn2cc(CNC(=O)NCCC(c3ccccc3)c3ccccc3)nc2c1 |
| InChI | InChI=1S/C25H26N4O/c1-19-13-15-29-18-22(28-24(29)16-19)17-27-25(30)26-14-12-23(20-8-4-2-5-9-20)21-10-6-3-7-11-21/h2-11,13,15-16,18,23H,12,14,17H2,1H3,(H2,26,27,30) |
| InChIKey | YARRAFGUZITHNV-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 58.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |