C20H17ClN4O — CID 55909509
3-chloro-N-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1H-indole-2-carboxamide (PubChem CID 55909509) has the molecular formula C20H17ClN4O and a molecular weight of 364.84 g/mol. Its IUPAC name is 3-chloro-N-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-chloro-N-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 55909509 |
| Molecular Formula | C20H17ClN4O |
| Molecular Weight | 364.84 g/mol |
| Exact Mass | 364.11 |
| IUPAC Name | 3-chloro-N-[[4-(pyrazol-1-ylmethyl)phenyl]methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(Cn2cccn2)cc1)c1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C20H17ClN4O/c21-18-16-4-1-2-5-17(16)24-19(18)20(26)22-12-14-6-8-15(9-7-14)13-25-11-3-10-23-25/h1-11,24H,12-13H2,(H,22,26) |
| InChIKey | VCPGXCZINOMOEH-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.84 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |