C19H14ClFN4O — CID 47799450
3-chloro-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1H-indole-2-carboxamide (PubChem CID 47799450) has the molecular formula C19H14ClFN4O and a molecular weight of 368.80 g/mol. Its IUPAC name is 3-chloro-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1H-indole-2-carboxamide.
| Compound Name | 3-chloro-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 47799450 |
| Molecular Formula | C19H14ClFN4O |
| Molecular Weight | 368.80 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | 3-chloro-N-[(3-fluoro-4-imidazol-1-ylphenyl)methyl]-1H-indole-2-carboxamide |
| SMILES | O=C(NCc1ccc(-n2ccnc2)c(F)c1)c1[nH]c2ccccc2c1Cl |
| InChI | InChI=1S/C19H14ClFN4O/c20-17-13-3-1-2-4-15(13)24-18(17)19(26)23-10-12-5-6-16(14(21)9-12)25-8-7-22-11-25/h1-9,11,24H,10H2,(H,23,26) |
| InChIKey | XYNICSUSOCDKNF-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 62.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.80 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |