C23H28N4O5S — CID 55909975
1-(4-acetylphenyl)sulfonyl-N-(5-morpholin-4-yl-2-pyridinyl)piperidine-2-carboxamide (PubChem CID 55909975) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-(5-morpholin-4-yl-2-pyridinyl)piperidine-2-carboxamide.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-(5-morpholin-4-yl-2-pyridinyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55909975 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-(5-morpholin-4-yl-2-pyridinyl)piperidine-2-carboxamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)Nc2ccc(N3CCOCC3)cn2)cc1 |
| InChI | InChI=1S/C23H28N4O5S/c1-17(28)18-5-8-20(9-6-18)33(30,31)27-11-3-2-4-21(27)23(29)25-22-10-7-19(16-24-22)26-12-14-32-15-13-26/h5-10,16,21H,2-4,11-15H2,1H3,(H,24,25,29) |
| InChIKey | XQVWYSRRJYBHOA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 108.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |