C25H32N4O4S — CID 55359494
1-(4-acetylphenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-2-carboxamide (PubChem CID 55359494) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is 1-(4-acetylphenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-2-carboxamide.
| Compound Name | 1-(4-acetylphenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 55359494 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | 1-(4-acetylphenyl)sulfonyl-N-[4-(4-methylpiperazin-1-yl)phenyl]piperidine-2-carboxamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)N2CCCCC2C(=O)Nc2ccc(N3CCN(C)CC3)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-19(30)20-6-12-23(13-7-20)34(32,33)29-14-4-3-5-24(29)25(31)26-21-8-10-22(11-9-21)28-17-15-27(2)16-18-28/h6-13,24H,3-5,14-18H2,1-2H3,(H,26,31) |
| InChIKey | AYNHJWMCQLADMH-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|