C24H32N4O4 — CID 55911236
4-(2,4-dimethoxybenzoyl)-N-[3-(N-methylanilino)propyl]piperazine-1-carboxamide (PubChem CID 55911236) has the molecular formula C24H32N4O4 and a molecular weight of 440.54 g/mol. Its IUPAC name is 4-(2,4-dimethoxybenzoyl)-N-[3-(N-methylanilino)propyl]piperazine-1-carboxamide.
| Compound Name | 4-(2,4-dimethoxybenzoyl)-N-[3-(N-methylanilino)propyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55911236 |
| Molecular Formula | C24H32N4O4 |
| Molecular Weight | 440.54 g/mol |
| Exact Mass | 440.24 |
| IUPAC Name | 4-(2,4-dimethoxybenzoyl)-N-[3-(N-methylanilino)propyl]piperazine-1-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCN(C(=O)NCCCN(C)c3ccccc3)CC2)c(OC)c1 |
| InChI | InChI=1S/C24H32N4O4/c1-26(19-8-5-4-6-9-19)13-7-12-25-24(30)28-16-14-27(15-17-28)23(29)21-11-10-20(31-2)18-22(21)32-3/h4-6,8-11,18H,7,12-17H2,1-3H3,(H,25,30) |
| InChIKey | UGRHOJLAPKOJTG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.54 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|