C20H24FN3O5S — CID 55913791
3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]-N-ethyl-4-fluorobenzenesulfonamide (PubChem CID 55913791) has the molecular formula C20H24FN3O5S and a molecular weight of 437.49 g/mol. Its IUPAC name is 3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]-N-ethyl-4-fluorobenzenesulfonamide.
| Compound Name | 3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]-N-ethyl-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 55913791 |
| Molecular Formula | C20H24FN3O5S |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | 3-[[2-(2,3-dimethylphenoxy)propanoylamino]carbamoyl]-N-ethyl-4-fluorobenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(F)c(C(=O)NNC(=O)C(C)Oc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C20H24FN3O5S/c1-5-22-30(27,28)15-9-10-17(21)16(11-15)20(26)24-23-19(25)14(4)29-18-8-6-7-12(2)13(18)3/h6-11,14,22H,5H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | MFXDVLOBPYFVBW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|