C17H16ClN5O4S — CID 55913910
4-chloro-N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-nitrobenzenesulfonamide (PubChem CID 55913910) has the molecular formula C17H16ClN5O4S and a molecular weight of 421.87 g/mol. Its IUPAC name is 4-chloro-N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-nitrobenzenesulfonamide.
| Compound Name | 4-chloro-N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 55913910 |
| Molecular Formula | C17H16ClN5O4S |
| Molecular Weight | 421.87 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 4-chloro-N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-nitrobenzenesulfonamide |
| SMILES | Cc1cc(C)n(-c2ccc(CNS(=O)(=O)c3ccc(Cl)cc3[N+](=O)[O-])cn2)n1 |
| InChI | InChI=1S/C17H16ClN5O4S/c1-11-7-12(2)22(21-11)17-6-3-13(9-19-17)10-20-28(26,27)16-5-4-14(18)8-15(16)23(24)25/h3-9,20H,10H2,1-2H3 |
| InChIKey | ZVIFJIXDXWBMTG-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.87 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|