C21H20N6O2 — CID 133436778
N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine (PubChem CID 133436778) has the molecular formula C21H20N6O2 and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine.
| Compound Name | N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine |
|---|---|
| PubChem CID | 133436778 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine |
| SMILES | Cc1cc(NCc2ccc(-n3nc(C)cc3C)nc2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C21H20N6O2/c1-13-10-18(17-5-4-6-19(27(28)29)21(17)24-13)22-11-16-7-8-20(23-12-16)26-15(3)9-14(2)25-26/h4-10,12H,11H2,1-3H3,(H,22,24) |
| InChIKey | LUTCNTBMKBUULL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|