About N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine
N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine (PubChem CID 133436778) has the molecular formula C21H20N6O2
and a molecular weight of 388.43 g/mol. Its IUPAC name is N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine.
Molecular Properties
| Compound Name | N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine |
| PubChem CID | 133436778 |
| Molecular Formula | C21H20N6O2 |
| Molecular Weight | 388.43 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine |
| SMILES | Cc1cc(NCc2ccc(-n3nc(C)cc3C)nc2)c2cccc([N+](=O)[O-])c2n1 |
| InChI | InChI=1S/C21H20N6O2/c1-13-10-18(17-5-4-6-19(27(28)29)21(17)24-13)22-11-16-7-8-20(23-12-16)26-15(3)9-14(2)25-26/h4-10,12H,11H2,1-3H3,(H,22,24) |
| InChIKey | LUTCNTBMKBUULL-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 388.43 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine?
The IUPAC name of N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine (CID 133436778) is N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine.
What is the SMILES notation for N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine?
The canonical SMILES for N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine is Cc1cc(NCc2ccc(-n3nc(C)cc3C)nc2)c2cccc([N+](=O)[O-])c2n1.
What is the InChIKey of N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine?
The InChIKey is LUTCNTBMKBUULL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H20N6O2/c1-13-10-18(17-5-4-6-19(27(28)29)21(17)24-13)22-11-16-7-8-20(23-12-16)26-15(3)9-14(2)25-26/h4-10,12H,11H2,1-3H3,(H,22,24).
What are the key properties of N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine?
N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine has a molecular weight of 388.43 g/mol, XLogP of 4.26, 5 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[6-(3,5-dimethylpyrazol-1-yl)-3-pyridinyl]methyl]-2-methyl-8-nitroquinolin-4-amine is sourced from PubChem (CID 133436778), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).