C23H26N4O3 — CID 55914067
[1-(2-methylpropyl)indol-3-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 55914067) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is [1-(2-methylpropyl)indol-3-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(2-methylpropyl)indol-3-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 55914067 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | [1-(2-methylpropyl)indol-3-yl]-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | CC(C)Cn1cc(C(=O)N2CCN(c3ccccc3[N+](=O)[O-])CC2)c2ccccc21 |
| InChI | InChI=1S/C23H26N4O3/c1-17(2)15-26-16-19(18-7-3-4-8-20(18)26)23(28)25-13-11-24(12-14-25)21-9-5-6-10-22(21)27(29)30/h3-10,16-17H,11-15H2,1-2H3 |
| InChIKey | CTPJGOHQWQBQPK-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|