C26H23N5O3 — CID 26287013
(1,3-diphenylpyrazol-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone (PubChem CID 26287013) has the molecular formula C26H23N5O3 and a molecular weight of 453.50 g/mol. Its IUPAC name is (1,3-diphenylpyrazol-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone.
| Compound Name | (1,3-diphenylpyrazol-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 26287013 |
| Molecular Formula | C26H23N5O3 |
| Molecular Weight | 453.50 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | (1,3-diphenylpyrazol-4-yl)-[4-(2-nitrophenyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn(-c2ccccc2)nc1-c1ccccc1)N1CCN(c2ccccc2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C26H23N5O3/c32-26(29-17-15-28(16-18-29)23-13-7-8-14-24(23)31(33)34)22-19-30(21-11-5-2-6-12-21)27-25(22)20-9-3-1-4-10-20/h1-14,19H,15-18H2 |
| InChIKey | JAFPSNHIYCRXCJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.50 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|