C21H24F2N2O4 — CID 55916657
ethyl 3-[[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-ethylamino]benzoate (PubChem CID 55916657) has the molecular formula C21H24F2N2O4 and a molecular weight of 406.43 g/mol. Its IUPAC name is ethyl 3-[[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-ethylamino]benzoate.
| Compound Name | ethyl 3-[[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-ethylamino]benzoate |
|---|---|
| PubChem CID | 55916657 |
| Molecular Formula | C21H24F2N2O4 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.17 |
| IUPAC Name | ethyl 3-[[2-[[4-(difluoromethoxy)phenyl]methylamino]-2-oxoethyl]-ethylamino]benzoate |
| SMILES | CCOC(=O)c1cccc(N(CC)CC(=O)NCc2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C21H24F2N2O4/c1-3-25(17-7-5-6-16(12-17)20(27)28-4-2)14-19(26)24-13-15-8-10-18(11-9-15)29-21(22)23/h5-12,21H,3-4,13-14H2,1-2H3,(H,24,26) |
| InChIKey | MMBMZCJSOWKMQT-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |