C21H19FN6O2S — CID 55917158
6-(4-fluorophenyl)-2-[4-[(2-nitrophenyl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 55917158) has the molecular formula C21H19FN6O2S and a molecular weight of 438.49 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-2-[4-[(2-nitrophenyl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-(4-fluorophenyl)-2-[4-[(2-nitrophenyl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 55917158 |
| Molecular Formula | C21H19FN6O2S |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | 6-(4-fluorophenyl)-2-[4-[(2-nitrophenyl)methyl]piperazin-1-yl]imidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | O=[N+]([O-])c1ccccc1CN1CCN(c2nn3cc(-c4ccc(F)cc4)nc3s2)CC1 |
| InChI | InChI=1S/C21H19FN6O2S/c22-17-7-5-15(6-8-17)18-14-27-20(23-18)31-21(24-27)26-11-9-25(10-12-26)13-16-3-1-2-4-19(16)28(29)30/h1-8,14H,9-13H2 |
| InChIKey | SMHYLZOIBOHBBM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 79.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|