C23H26N4O2 — CID 55919363
1-phenyl-3-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione (PubChem CID 55919363) has the molecular formula C23H26N4O2 and a molecular weight of 390.49 g/mol. Its IUPAC name is 1-phenyl-3-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione.
| Compound Name | 1-phenyl-3-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55919363 |
| Molecular Formula | C23H26N4O2 |
| Molecular Weight | 390.49 g/mol |
| Exact Mass | 390.21 |
| IUPAC Name | 1-phenyl-3-[[4-[(E)-3-phenylprop-2-enyl]piperazin-1-yl]methyl]imidazolidine-2,4-dione |
| SMILES | O=C1CN(c2ccccc2)C(=O)N1CN1CCN(C/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C23H26N4O2/c28-22-18-26(21-11-5-2-6-12-21)23(29)27(22)19-25-16-14-24(15-17-25)13-7-10-20-8-3-1-4-9-20/h1-12H,13-19H2/b10-7+ |
| InChIKey | HPDXHJYDOFKWFX-JXMROGBWSA-N |
| XLogP | 2.74 |
| TPSA | 47.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|