C21H28N2O3S2 — CID 55923006
N-(3-methyl-1-thiophen-2-ylbutyl)-3-piperidin-1-ylsulfonylbenzamide (PubChem CID 55923006) has the molecular formula C21H28N2O3S2 and a molecular weight of 420.60 g/mol. Its IUPAC name is N-(3-methyl-1-thiophen-2-ylbutyl)-3-piperidin-1-ylsulfonylbenzamide.
| Compound Name | N-(3-methyl-1-thiophen-2-ylbutyl)-3-piperidin-1-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 55923006 |
| Molecular Formula | C21H28N2O3S2 |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | N-(3-methyl-1-thiophen-2-ylbutyl)-3-piperidin-1-ylsulfonylbenzamide |
| SMILES | CC(C)CC(NC(=O)c1cccc(S(=O)(=O)N2CCCCC2)c1)c1cccs1 |
| InChI | InChI=1S/C21H28N2O3S2/c1-16(2)14-19(20-10-7-13-27-20)22-21(24)17-8-6-9-18(15-17)28(25,26)23-11-4-3-5-12-23/h6-10,13,15-16,19H,3-5,11-12,14H2,1-2H3,(H,22,24) |
| InChIKey | KKKZMXWEVGEYDH-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |