C24H27N5O3 — CID 55923111
N-(2-benzamidoethyl)-4-[2-(1H-indol-3-yl)acetyl]piperazine-1-carboxamide (PubChem CID 55923111) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-4-[2-(1H-indol-3-yl)acetyl]piperazine-1-carboxamide.
| Compound Name | N-(2-benzamidoethyl)-4-[2-(1H-indol-3-yl)acetyl]piperazine-1-carboxamide |
|---|---|
| PubChem CID | 55923111 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | N-(2-benzamidoethyl)-4-[2-(1H-indol-3-yl)acetyl]piperazine-1-carboxamide |
| SMILES | O=C(NCCNC(=O)N1CCN(C(=O)Cc2c[nH]c3ccccc23)CC1)c1ccccc1 |
| InChI | InChI=1S/C24H27N5O3/c30-22(16-19-17-27-21-9-5-4-8-20(19)21)28-12-14-29(15-13-28)24(32)26-11-10-25-23(31)18-6-2-1-3-7-18/h1-9,17,27H,10-16H2,(H,25,31)(H,26,32) |
| InChIKey | FJGWEWTYYSRIGP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 97.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|