C20H26N4O2 — CID 55923777
1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea (PubChem CID 55923777) has the molecular formula C20H26N4O2 and a molecular weight of 354.45 g/mol. Its IUPAC name is 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea.
| Compound Name | 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea |
|---|---|
| PubChem CID | 55923777 |
| Molecular Formula | C20H26N4O2 |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | 1-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-(1-methyl-4,5,6,7-tetrahydroindazol-4-yl)urea |
| SMILES | Cn1ncc2c1CCCC2NC(=O)NCCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H26N4O2/c1-24-19-7-3-6-18(17(19)13-22-24)23-20(25)21-10-11-26-16-9-8-14-4-2-5-15(14)12-16/h8-9,12-13,18H,2-7,10-11H2,1H3,(H2,21,23,25) |
| InChIKey | AMVAGSJYDOVRAA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 68.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|