C19H22ClNO4S — CID 55925620
(5-chlorothiophen-2-yl)methyl (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 55925620) has the molecular formula C19H22ClNO4S and a molecular weight of 395.91 g/mol. Its IUPAC name is (5-chlorothiophen-2-yl)methyl (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | (5-chlorothiophen-2-yl)methyl (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 55925620 |
| Molecular Formula | C19H22ClNO4S |
| Molecular Weight | 395.91 g/mol |
| Exact Mass | 395.10 |
| IUPAC Name | (5-chlorothiophen-2-yl)methyl (2S)-2-[(4-ethoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | CCOc1ccc(C(=O)N[C@H](C(=O)OCc2ccc(Cl)s2)C(C)C)cc1 |
| InChI | InChI=1S/C19H22ClNO4S/c1-4-24-14-7-5-13(6-8-14)18(22)21-17(12(2)3)19(23)25-11-15-9-10-16(20)26-15/h5-10,12,17H,4,11H2,1-3H3,(H,21,22)/t17-/m0/s1 |
| InChIKey | GOTMXVAEQGVJES-KRWDZBQOSA-N |
| XLogP | 4.30 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.91 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |