C24H25FN2O8 — CID 55926713
dimethyl 5-[[2-[(2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate (PubChem CID 55926713) has the molecular formula C24H25FN2O8 and a molecular weight of 488.47 g/mol. Its IUPAC name is dimethyl 5-[[2-[(2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[[2-[(2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 55926713 |
| Molecular Formula | C24H25FN2O8 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | dimethyl 5-[[2-[(2S)-2-[(2-fluorobenzoyl)amino]-3-methylbutanoyl]oxyacetyl]amino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=O)COC(=O)[C@@H](NC(=O)c2ccccc2F)C(C)C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C24H25FN2O8/c1-13(2)20(27-21(29)17-7-5-6-8-18(17)25)24(32)35-12-19(28)26-16-10-14(22(30)33-3)9-15(11-16)23(31)34-4/h5-11,13,20H,12H2,1-4H3,(H,26,28)(H,27,29)/t20-/m0/s1 |
| InChIKey | RCZTWEUFNDCNSH-FQEVSTJZSA-N |
| XLogP | 2.34 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|