C20H20F2N2O2 — CID 55929836
2-(2-cyanophenoxy)-N-[1-(2,4-difluorophenyl)ethyl]-3-methylbutanamide (PubChem CID 55929836) has the molecular formula C20H20F2N2O2 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-(2-cyanophenoxy)-N-[1-(2,4-difluorophenyl)ethyl]-3-methylbutanamide.
| Compound Name | 2-(2-cyanophenoxy)-N-[1-(2,4-difluorophenyl)ethyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 55929836 |
| Molecular Formula | C20H20F2N2O2 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-(2-cyanophenoxy)-N-[1-(2,4-difluorophenyl)ethyl]-3-methylbutanamide |
| SMILES | CC(NC(=O)C(Oc1ccccc1C#N)C(C)C)c1ccc(F)cc1F |
| InChI | InChI=1S/C20H20F2N2O2/c1-12(2)19(26-18-7-5-4-6-14(18)11-23)20(25)24-13(3)16-9-8-15(21)10-17(16)22/h4-10,12-13,19H,1-3H3,(H,24,25) |
| InChIKey | GMOOAHMPPCELOI-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 62.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |