C26H24FN3O3 — CID 55947736
N-[3-[[[2-(2-cyanophenoxy)-3-methylbutanoyl]amino]methyl]phenyl]-3-fluorobenzamide (PubChem CID 55947736) has the molecular formula C26H24FN3O3 and a molecular weight of 445.49 g/mol. Its IUPAC name is N-[3-[[[2-(2-cyanophenoxy)-3-methylbutanoyl]amino]methyl]phenyl]-3-fluorobenzamide.
| Compound Name | N-[3-[[[2-(2-cyanophenoxy)-3-methylbutanoyl]amino]methyl]phenyl]-3-fluorobenzamide |
|---|---|
| PubChem CID | 55947736 |
| Molecular Formula | C26H24FN3O3 |
| Molecular Weight | 445.49 g/mol |
| Exact Mass | 445.18 |
| IUPAC Name | N-[3-[[[2-(2-cyanophenoxy)-3-methylbutanoyl]amino]methyl]phenyl]-3-fluorobenzamide |
| SMILES | CC(C)C(Oc1ccccc1C#N)C(=O)NCc1cccc(NC(=O)c2cccc(F)c2)c1 |
| InChI | InChI=1S/C26H24FN3O3/c1-17(2)24(33-23-12-4-3-8-20(23)15-28)26(32)29-16-18-7-5-11-22(13-18)30-25(31)19-9-6-10-21(27)14-19/h3-14,17,24H,16H2,1-2H3,(H,29,32)(H,30,31) |
| InChIKey | NXBRWGAMBBPUQY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 91.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.49 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |