C26H30N4O4S — CID 55931856
N-(3-benzylsulfonylpropyl)-6-(2,5-dimethylfuran-3-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide (PubChem CID 55931856) has the molecular formula C26H30N4O4S and a molecular weight of 494.62 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-6-(2,5-dimethylfuran-3-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-6-(2,5-dimethylfuran-3-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 55931856 |
| Molecular Formula | C26H30N4O4S |
| Molecular Weight | 494.62 g/mol |
| Exact Mass | 494.20 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-6-(2,5-dimethylfuran-3-yl)-1-propan-2-ylpyrazolo[5,4-b]pyridine-4-carboxamide |
| SMILES | Cc1cc(-c2cc(C(=O)NCCCS(=O)(=O)Cc3ccccc3)c3cnn(C(C)C)c3n2)c(C)o1 |
| InChI | InChI=1S/C26H30N4O4S/c1-17(2)30-25-23(15-28-30)22(14-24(29-25)21-13-18(3)34-19(21)4)26(31)27-11-8-12-35(32,33)16-20-9-6-5-7-10-20/h5-7,9-10,13-15,17H,8,11-12,16H2,1-4H3,(H,27,31) |
| InChIKey | DCIOYFZMCQNLDH-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.62 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|