C20H20FN5O2 — CID 55932406
2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide (PubChem CID 55932406) has the molecular formula C20H20FN5O2 and a molecular weight of 381.41 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide.
| Compound Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 55932406 |
| Molecular Formula | C20H20FN5O2 |
| Molecular Weight | 381.41 g/mol |
| Exact Mass | 381.16 |
| IUPAC Name | 2-[(4-fluorophenyl)methylcarbamoylamino]-N-[2-(pyrazol-1-ylmethyl)phenyl]acetamide |
| SMILES | O=C(CNC(=O)NCc1ccc(F)cc1)Nc1ccccc1Cn1cccn1 |
| InChI | InChI=1S/C20H20FN5O2/c21-17-8-6-15(7-9-17)12-22-20(28)23-13-19(27)25-18-5-2-1-4-16(18)14-26-11-3-10-24-26/h1-11H,12-14H2,(H,25,27)(H2,22,23,28) |
| InChIKey | BUYPAUWHKGZAMH-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 88.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |