C19H25N3O6S2 — CID 55938697
(2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[(3-sulfamoylphenyl)methyl]butanamide (PubChem CID 55938697) has the molecular formula C19H25N3O6S2 and a molecular weight of 455.56 g/mol. Its IUPAC name is (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[(3-sulfamoylphenyl)methyl]butanamide.
| Compound Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[(3-sulfamoylphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 55938697 |
| Molecular Formula | C19H25N3O6S2 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.12 |
| IUPAC Name | (2S)-2-[(4-methoxyphenyl)sulfonylamino]-3-methyl-N-[(3-sulfamoylphenyl)methyl]butanamide |
| SMILES | COc1ccc(S(=O)(=O)N[C@H](C(=O)NCc2cccc(S(N)(=O)=O)c2)C(C)C)cc1 |
| InChI | InChI=1S/C19H25N3O6S2/c1-13(2)18(22-30(26,27)16-9-7-15(28-3)8-10-16)19(23)21-12-14-5-4-6-17(11-14)29(20,24)25/h4-11,13,18,22H,12H2,1-3H3,(H,21,23)(H2,20,24,25)/t18-/m0/s1 |
| InChIKey | ZUTRXDOFWACOJQ-SFHVURJKSA-N |
| XLogP | 0.96 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |