C21H25N3O4S2 — CID 55942502
(4R)-3-benzoyl-N-[4-(diethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 55942502) has the molecular formula C21H25N3O4S2 and a molecular weight of 447.58 g/mol. Its IUPAC name is (4R)-3-benzoyl-N-[4-(diethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-benzoyl-N-[4-(diethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55942502 |
| Molecular Formula | C21H25N3O4S2 |
| Molecular Weight | 447.58 g/mol |
| Exact Mass | 447.13 |
| IUPAC Name | (4R)-3-benzoyl-N-[4-(diethylsulfamoyl)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(NC(=O)[C@@H]2CSCN2C(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C21H25N3O4S2/c1-3-23(4-2)30(27,28)18-12-10-17(11-13-18)22-20(25)19-14-29-15-24(19)21(26)16-8-6-5-7-9-16/h5-13,19H,3-4,14-15H2,1-2H3,(H,22,25)/t19-/m0/s1 |
| InChIKey | DLULEHPLMXQGAA-IBGZPJMESA-N |
| XLogP | 2.87 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.58 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |