C23H18N2O3S — CID 55796095
3-benzoyl-N-dibenzofuran-3-yl-1,3-thiazolidine-4-carboxamide (PubChem CID 55796095) has the molecular formula C23H18N2O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 3-benzoyl-N-dibenzofuran-3-yl-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-dibenzofuran-3-yl-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55796095 |
| Molecular Formula | C23H18N2O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | 3-benzoyl-N-dibenzofuran-3-yl-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2c(c1)oc1ccccc12)C1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C23H18N2O3S/c26-22(19-13-29-14-25(19)23(27)15-6-2-1-3-7-15)24-16-10-11-18-17-8-4-5-9-20(17)28-21(18)12-16/h1-12,19H,13-14H2,(H,24,26) |
| InChIKey | YNWKJYZNGUNJEA-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |