C17H14F2N2O2S — CID 51330773
3-benzoyl-N-(2,4-difluorophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 51330773) has the molecular formula C17H14F2N2O2S and a molecular weight of 348.37 g/mol. Its IUPAC name is 3-benzoyl-N-(2,4-difluorophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-benzoyl-N-(2,4-difluorophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 51330773 |
| Molecular Formula | C17H14F2N2O2S |
| Molecular Weight | 348.37 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | 3-benzoyl-N-(2,4-difluorophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(F)cc1F)C1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14F2N2O2S/c18-12-6-7-14(13(19)8-12)20-16(22)15-9-24-10-21(15)17(23)11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,22) |
| InChIKey | DBPGJGUVJRCIBO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |