C20H17N3O2S2 — CID 52716359
(4R)-3-benzoyl-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 52716359) has the molecular formula C20H17N3O2S2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (4R)-3-benzoyl-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-benzoyl-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 52716359 |
| Molecular Formula | C20H17N3O2S2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.08 |
| IUPAC Name | (4R)-3-benzoyl-N-(4-phenyl-1,3-thiazol-2-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1nc(-c2ccccc2)cs1)[C@@H]1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H17N3O2S2/c24-18(22-20-21-16(11-27-20)14-7-3-1-4-8-14)17-12-26-13-23(17)19(25)15-9-5-2-6-10-15/h1-11,17H,12-13H2,(H,21,22,24)/t17-/m0/s1 |
| InChIKey | ZUUVQZDWPFBPKO-KRWDZBQOSA-N |
| XLogP | 3.96 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |