C17H14Cl2N2O2S — CID 52716357
(4R)-3-benzoyl-N-(2,5-dichlorophenyl)-1,3-thiazolidine-4-carboxamide (PubChem CID 52716357) has the molecular formula C17H14Cl2N2O2S and a molecular weight of 381.28 g/mol. Its IUPAC name is (4R)-3-benzoyl-N-(2,5-dichlorophenyl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-benzoyl-N-(2,5-dichlorophenyl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 52716357 |
| Molecular Formula | C17H14Cl2N2O2S |
| Molecular Weight | 381.28 g/mol |
| Exact Mass | 380.02 |
| IUPAC Name | (4R)-3-benzoyl-N-(2,5-dichlorophenyl)-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1cc(Cl)ccc1Cl)[C@@H]1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14Cl2N2O2S/c18-12-6-7-13(19)14(8-12)20-16(22)15-9-24-10-21(15)17(23)11-4-2-1-3-5-11/h1-8,15H,9-10H2,(H,20,22)/t15-/m0/s1 |
| InChIKey | DTSROABNOSZRDG-HNNXBMFYSA-N |
| XLogP | 4.15 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.28 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |