C18H16N6O2S — CID 55941327
(4R)-3-benzoyl-N-[4-(tetrazol-1-yl)phenyl]-1,3-thiazolidine-4-carboxamide (PubChem CID 55941327) has the molecular formula C18H16N6O2S and a molecular weight of 380.43 g/mol. Its IUPAC name is (4R)-3-benzoyl-N-[4-(tetrazol-1-yl)phenyl]-1,3-thiazolidine-4-carboxamide.
| Compound Name | (4R)-3-benzoyl-N-[4-(tetrazol-1-yl)phenyl]-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 55941327 |
| Molecular Formula | C18H16N6O2S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | (4R)-3-benzoyl-N-[4-(tetrazol-1-yl)phenyl]-1,3-thiazolidine-4-carboxamide |
| SMILES | O=C(Nc1ccc(-n2cnnn2)cc1)[C@@H]1CSCN1C(=O)c1ccccc1 |
| InChI | InChI=1S/C18H16N6O2S/c25-17(20-14-6-8-15(9-7-14)24-11-19-21-22-24)16-10-27-12-23(16)18(26)13-4-2-1-3-5-13/h1-9,11,16H,10,12H2,(H,20,25)/t16-/m0/s1 |
| InChIKey | TUGNQDKWRJDKGY-INIZCTEOSA-N |
| XLogP | 1.82 |
| TPSA | 93.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |