C28H29N3O4 — CID 55943091
(2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-phenylpropanamide (PubChem CID 55943091) has the molecular formula C28H29N3O4 and a molecular weight of 471.56 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-phenylpropanamide.
| Compound Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 55943091 |
| Molecular Formula | C28H29N3O4 |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | (2S)-2-(1,3-dioxoisoindol-2-yl)-N-[2-(furan-2-yl)-2-piperidin-1-ylethyl]-3-phenylpropanamide |
| SMILES | O=C(NCC(c1ccco1)N1CCCCC1)[C@H](Cc1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C28H29N3O4/c32-26(29-19-24(25-14-9-17-35-25)30-15-7-2-8-16-30)23(18-20-10-3-1-4-11-20)31-27(33)21-12-5-6-13-22(21)28(31)34/h1,3-6,9-14,17,23-24H,2,7-8,15-16,18-19H2,(H,29,32)/t23-,24?/m0/s1 |
| InChIKey | AGMAKNGMJUZLAG-UXMRNZNESA-N |
| XLogP | 3.83 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|