C20H23N3O7S — CID 55944046
[3-(ethoxycarbonylamino)phenyl] (2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoate (PubChem CID 55944046) has the molecular formula C20H23N3O7S and a molecular weight of 449.49 g/mol. Its IUPAC name is [3-(ethoxycarbonylamino)phenyl] (2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoate.
| Compound Name | [3-(ethoxycarbonylamino)phenyl] (2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 55944046 |
| Molecular Formula | C20H23N3O7S |
| Molecular Weight | 449.49 g/mol |
| Exact Mass | 449.13 |
| IUPAC Name | [3-(ethoxycarbonylamino)phenyl] (2S)-2-[(4-acetamidophenyl)sulfonylamino]propanoate |
| SMILES | CCOC(=O)Nc1cccc(OC(=O)[C@H](C)NS(=O)(=O)c2ccc(NC(C)=O)cc2)c1 |
| InChI | InChI=1S/C20H23N3O7S/c1-4-29-20(26)22-16-6-5-7-17(12-16)30-19(25)13(2)23-31(27,28)18-10-8-15(9-11-18)21-14(3)24/h5-13,23H,4H2,1-3H3,(H,21,24)(H,22,26)/t13-/m0/s1 |
| InChIKey | DJOKIWCRVHDGES-ZDUSSCGKSA-N |
| XLogP | 2.49 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.49 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|