C24H21FN4O4S — CID 55945386
N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-(4-oxocinnolin-1-yl)acetamide (PubChem CID 55945386) has the molecular formula C24H21FN4O4S and a molecular weight of 480.52 g/mol. Its IUPAC name is N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-(4-oxocinnolin-1-yl)acetamide.
| Compound Name | N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-(4-oxocinnolin-1-yl)acetamide |
|---|---|
| PubChem CID | 55945386 |
| Molecular Formula | C24H21FN4O4S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N-[[3-[(3-fluorophenyl)methylsulfamoyl]phenyl]methyl]-2-(4-oxocinnolin-1-yl)acetamide |
| SMILES | O=C(Cn1ncc(=O)c2ccccc21)NCc1cccc(S(=O)(=O)NCc2cccc(F)c2)c1 |
| InChI | InChI=1S/C24H21FN4O4S/c25-19-7-3-5-17(11-19)14-28-34(32,33)20-8-4-6-18(12-20)13-26-24(31)16-29-22-10-2-1-9-21(22)23(30)15-27-29/h1-12,15,28H,13-14,16H2,(H,26,31) |
| InChIKey | AKBYFRCIMYQIDP-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |