C21H28N4O3 — CID 55949640
N-butyl-N-methyl-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-4-carboxamide (PubChem CID 55949640) has the molecular formula C21H28N4O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is N-butyl-N-methyl-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-4-carboxamide.
| Compound Name | N-butyl-N-methyl-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55949640 |
| Molecular Formula | C21H28N4O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.22 |
| IUPAC Name | N-butyl-N-methyl-1-[2-(4-oxocinnolin-1-yl)acetyl]piperidine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)C1CCN(C(=O)Cn2ncc(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C21H28N4O3/c1-3-4-11-23(2)21(28)16-9-12-24(13-10-16)20(27)15-25-18-8-6-5-7-17(18)19(26)14-22-25/h5-8,14,16H,3-4,9-13,15H2,1-2H3 |
| InChIKey | HYNXQVUVRHBMFE-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 75.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |