C14H17N3O3 — CID 78855476
N-ethyl-N-(2-hydroxyethyl)-2-(4-oxocinnolin-1-yl)acetamide (PubChem CID 78855476) has the molecular formula C14H17N3O3 and a molecular weight of 275.31 g/mol. Its IUPAC name is N-ethyl-N-(2-hydroxyethyl)-2-(4-oxocinnolin-1-yl)acetamide.
| Compound Name | N-ethyl-N-(2-hydroxyethyl)-2-(4-oxocinnolin-1-yl)acetamide |
|---|---|
| PubChem CID | 78855476 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-ethyl-N-(2-hydroxyethyl)-2-(4-oxocinnolin-1-yl)acetamide |
| SMILES | CCN(CCO)C(=O)Cn1ncc(=O)c2ccccc21 |
| InChI | InChI=1S/C14H17N3O3/c1-2-16(7-8-18)14(20)10-17-12-6-4-3-5-11(12)13(19)9-15-17/h3-6,9,18H,2,7-8,10H2,1H3 |
| InChIKey | YJGUAIBSBOFAQK-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |