C21H23N3O4 — CID 55954518
2,3,4-trimethoxy-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide (PubChem CID 55954518) has the molecular formula C21H23N3O4 and a molecular weight of 381.43 g/mol. Its IUPAC name is 2,3,4-trimethoxy-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide.
| Compound Name | 2,3,4-trimethoxy-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 55954518 |
| Molecular Formula | C21H23N3O4 |
| Molecular Weight | 381.43 g/mol |
| Exact Mass | 381.17 |
| IUPAC Name | 2,3,4-trimethoxy-N-[[3-(pyrazol-1-ylmethyl)phenyl]methyl]benzamide |
| SMILES | COc1ccc(C(=O)NCc2cccc(Cn3cccn3)c2)c(OC)c1OC |
| InChI | InChI=1S/C21H23N3O4/c1-26-18-9-8-17(19(27-2)20(18)28-3)21(25)22-13-15-6-4-7-16(12-15)14-24-11-5-10-23-24/h4-12H,13-14H2,1-3H3,(H,22,25) |
| InChIKey | NGUKLANQPGXJIY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 74.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |