C20H16ClFN4O2 — CID 55956043
1-(4-chlorophenyl)-N-(3-fluoro-4-imidazol-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 55956043) has the molecular formula C20H16ClFN4O2 and a molecular weight of 398.83 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-N-(3-fluoro-4-imidazol-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-(4-chlorophenyl)-N-(3-fluoro-4-imidazol-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 55956043 |
| Molecular Formula | C20H16ClFN4O2 |
| Molecular Weight | 398.83 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | 1-(4-chlorophenyl)-N-(3-fluoro-4-imidazol-1-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccc(-n2ccnc2)c(F)c1)C1CC(=O)N(c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C20H16ClFN4O2/c21-14-1-4-16(5-2-14)26-11-13(9-19(26)27)20(28)24-15-3-6-18(17(22)10-15)25-8-7-23-12-25/h1-8,10,12-13H,9,11H2,(H,24,28) |
| InChIKey | KUOZAVFMUXYOMA-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.83 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |