C23H27N3O2 — CID 55956171
N,2,5-trimethyl-N-[3-(2-methylphenoxy)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 55956171) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N,2,5-trimethyl-N-[3-(2-methylphenoxy)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N,2,5-trimethyl-N-[3-(2-methylphenoxy)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 55956171 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N,2,5-trimethyl-N-[3-(2-methylphenoxy)propyl]-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1ccccc1OCCCN(C)C(=O)c1cc(C)n(-c2ccccn2)c1C |
| InChI | InChI=1S/C23H27N3O2/c1-17-10-5-6-11-21(17)28-15-9-14-25(4)23(27)20-16-18(2)26(19(20)3)22-12-7-8-13-24-22/h5-8,10-13,16H,9,14-15H2,1-4H3 |
| InChIKey | CICKCRAZZWCATP-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|