C17H21N3O3S — CID 42958266
N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethyl-1-pyridin-2-ylpyrrole-3-carboxamide (PubChem CID 42958266) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethyl-1-pyridin-2-ylpyrrole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42958266 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N,2,5-trimethyl-1-pyridin-2-ylpyrrole-3-carboxamide |
| SMILES | Cc1cc(C(=O)N(C)C2CCS(=O)(=O)C2)c(C)n1-c1ccccn1 |
| InChI | InChI=1S/C17H21N3O3S/c1-12-10-15(13(2)20(12)16-6-4-5-8-18-16)17(21)19(3)14-7-9-24(22,23)11-14/h4-6,8,10,14H,7,9,11H2,1-3H3 |
| InChIKey | JVQGRYBUCWFVKL-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|