C19H24N2O4S — CID 42925003
N-(1,1-dioxothiolan-3-yl)-1-(4-methoxyphenyl)-N,2,5-trimethylpyrrole-3-carboxamide (PubChem CID 42925003) has the molecular formula C19H24N2O4S and a molecular weight of 376.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-1-(4-methoxyphenyl)-N,2,5-trimethylpyrrole-3-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-1-(4-methoxyphenyl)-N,2,5-trimethylpyrrole-3-carboxamide |
|---|---|
| PubChem CID | 42925003 |
| Molecular Formula | C19H24N2O4S |
| Molecular Weight | 376.48 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-1-(4-methoxyphenyl)-N,2,5-trimethylpyrrole-3-carboxamide |
| SMILES | COc1ccc(-n2c(C)cc(C(=O)N(C)C3CCS(=O)(=O)C3)c2C)cc1 |
| InChI | InChI=1S/C19H24N2O4S/c1-13-11-18(19(22)20(3)16-9-10-26(23,24)12-16)14(2)21(13)15-5-7-17(25-4)8-6-15/h5-8,11,16H,9-10,12H2,1-4H3 |
| InChIKey | TYRHFEDAVPAFEX-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 68.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.48 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|