C24H25N3O3 — CID 55956332
8-methyl-3-[2-[4-(4-methylbenzoyl)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one (PubChem CID 55956332) has the molecular formula C24H25N3O3 and a molecular weight of 403.48 g/mol. Its IUPAC name is 8-methyl-3-[2-[4-(4-methylbenzoyl)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one.
| Compound Name | 8-methyl-3-[2-[4-(4-methylbenzoyl)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one |
|---|---|
| PubChem CID | 55956332 |
| Molecular Formula | C24H25N3O3 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.19 |
| IUPAC Name | 8-methyl-3-[2-[4-(4-methylbenzoyl)piperidin-1-yl]-2-oxoethyl]quinazolin-4-one |
| SMILES | Cc1ccc(C(=O)C2CCN(C(=O)Cn3cnc4c(C)cccc4c3=O)CC2)cc1 |
| InChI | InChI=1S/C24H25N3O3/c1-16-6-8-18(9-7-16)23(29)19-10-12-26(13-11-19)21(28)14-27-15-25-22-17(2)4-3-5-20(22)24(27)30/h3-9,15,19H,10-14H2,1-2H3 |
| InChIKey | LWJLKQRXIVOVIY-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 72.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |