C24H24ClN3O3S — CID 55956560
N-[2-chloro-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 55956560) has the molecular formula C24H24ClN3O3S and a molecular weight of 469.99 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55956560 |
| Molecular Formula | C24H24ClN3O3S |
| Molecular Weight | 469.99 g/mol |
| Exact Mass | 469.12 |
| IUPAC Name | N-[2-chloro-5-[4-(4-methoxyphenyl)-1,4-diazepane-1-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | COc1ccc(N2CCCN(C(=O)c3ccc(Cl)c(NC(=O)c4cccs4)c3)CC2)cc1 |
| InChI | InChI=1S/C24H24ClN3O3S/c1-31-19-8-6-18(7-9-19)27-11-3-12-28(14-13-27)24(30)17-5-10-20(25)21(16-17)26-23(29)22-4-2-15-32-22/h2,4-10,15-16H,3,11-14H2,1H3,(H,26,29) |
| InChIKey | YJZDPSXWTQPKDU-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.99 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|