C21H18Cl2N4O2S — CID 55861643
N-[2-chloro-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide (PubChem CID 55861643) has the molecular formula C21H18Cl2N4O2S and a molecular weight of 461.37 g/mol. Its IUPAC name is N-[2-chloro-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[2-chloro-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 55861643 |
| Molecular Formula | C21H18Cl2N4O2S |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 460.05 |
| IUPAC Name | N-[2-chloro-5-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-carboxamide |
| SMILES | O=C(Nc1cc(C(=O)N2CCN(c3cccc(Cl)n3)CC2)ccc1Cl)c1cccs1 |
| InChI | InChI=1S/C21H18Cl2N4O2S/c22-15-7-6-14(13-16(15)24-20(28)17-3-2-12-30-17)21(29)27-10-8-26(9-11-27)19-5-1-4-18(23)25-19/h1-7,12-13H,8-11H2,(H,24,28) |
| InChIKey | QUVRTJHSUNUFSU-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|