C20H19ClN4O3S2 — CID 55924296
N-[3-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide (PubChem CID 55924296) has the molecular formula C20H19ClN4O3S2 and a molecular weight of 462.98 g/mol. Its IUPAC name is N-[3-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55924296 |
| Molecular Formula | C20H19ClN4O3S2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 462.06 |
| IUPAC Name | N-[3-[4-(6-chloro-2-pyridinyl)piperazine-1-carbonyl]phenyl]thiophene-2-sulfonamide |
| SMILES | O=C(c1cccc(NS(=O)(=O)c2cccs2)c1)N1CCN(c2cccc(Cl)n2)CC1 |
| InChI | InChI=1S/C20H19ClN4O3S2/c21-17-6-2-7-18(22-17)24-9-11-25(12-10-24)20(26)15-4-1-5-16(14-15)23-30(27,28)19-8-3-13-29-19/h1-8,13-14,23H,9-12H2 |
| InChIKey | JQVADRWJHIBJLA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|