C17H20N2O4S2 — CID 55831038
N-[3-(2,5-dimethylmorpholine-4-carbonyl)phenyl]thiophene-2-sulfonamide (PubChem CID 55831038) has the molecular formula C17H20N2O4S2 and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[3-(2,5-dimethylmorpholine-4-carbonyl)phenyl]thiophene-2-sulfonamide.
| Compound Name | N-[3-(2,5-dimethylmorpholine-4-carbonyl)phenyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55831038 |
| Molecular Formula | C17H20N2O4S2 |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[3-(2,5-dimethylmorpholine-4-carbonyl)phenyl]thiophene-2-sulfonamide |
| SMILES | CC1CN(C(=O)c2cccc(NS(=O)(=O)c3cccs3)c2)C(C)CO1 |
| InChI | InChI=1S/C17H20N2O4S2/c1-12-11-23-13(2)10-19(12)17(20)14-5-3-6-15(9-14)18-25(21,22)16-7-4-8-24-16/h3-9,12-13,18H,10-11H2,1-2H3 |
| InChIKey | CRVBCQVIXQHIJB-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |