C22H28N4O5S — CID 55959090
1-[4-(2-methoxyethylsulfamoyl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide (PubChem CID 55959090) has the molecular formula C22H28N4O5S and a molecular weight of 460.56 g/mol. Its IUPAC name is 1-[4-(2-methoxyethylsulfamoyl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide.
| Compound Name | 1-[4-(2-methoxyethylsulfamoyl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 55959090 |
| Molecular Formula | C22H28N4O5S |
| Molecular Weight | 460.56 g/mol |
| Exact Mass | 460.18 |
| IUPAC Name | 1-[4-(2-methoxyethylsulfamoyl)benzoyl]-N-(3-methyl-2-pyridinyl)piperidine-3-carboxamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)N2CCCC(C(=O)Nc3ncccc3C)C2)cc1 |
| InChI | InChI=1S/C22H28N4O5S/c1-16-5-3-11-23-20(16)25-21(27)18-6-4-13-26(15-18)22(28)17-7-9-19(10-8-17)32(29,30)24-12-14-31-2/h3,5,7-11,18,24H,4,6,12-15H2,1-2H3,(H,23,25,27) |
| InChIKey | ZJTYCJAFLXXVRX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 117.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.56 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|